C14H20F6O2 — CID 170140135
1,1,1-trifluoro-6-methyl-4-(3-methylbuta-1,3-dien-2-yloxy)-2-(trifluoromethyl)heptan-2-ol (PubChem CID 170140135) has the molecular formula C14H20F6O2 and a molecular weight of 334.30 g/mol. Its IUPAC name is 1,1,1-trifluoro-6-methyl-4-(3-methylbuta-1,3-dien-2-yloxy)-2-(trifluoromethyl)heptan-2-ol.
| Compound Name | 1,1,1-trifluoro-6-methyl-4-(3-methylbuta-1,3-dien-2-yloxy)-2-(trifluoromethyl)heptan-2-ol |
|---|---|
| PubChem CID | 170140135 |
| Molecular Formula | C14H20F6O2 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1,1,1-trifluoro-6-methyl-4-(3-methylbuta-1,3-dien-2-yloxy)-2-(trifluoromethyl)heptan-2-ol |
| SMILES | C=C(C)C(=C)OC(CC(C)C)CC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H20F6O2/c1-8(2)6-11(22-10(5)9(3)4)7-12(21,13(15,16)17)14(18,19)20/h8,11,21H,3,5-7H2,1-2,4H3 |
| InChIKey | LWBDWMSOWBZEBE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|