C28H48F6O6 — CID 158930773
bis(1,1,1-trifluoro-2-hydroxy-2,6-dimethylheptan-4-yl) 2-ethyl-2,4,4-trimethylpentanedioate (PubChem CID 158930773) has the molecular formula C28H48F6O6 and a molecular weight of 594.67 g/mol. Its IUPAC name is bis(1,1,1-trifluoro-2-hydroxy-2,6-dimethylheptan-4-yl) 2-ethyl-2,4,4-trimethylpentanedioate.
| Compound Name | bis(1,1,1-trifluoro-2-hydroxy-2,6-dimethylheptan-4-yl) 2-ethyl-2,4,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 158930773 |
| Molecular Formula | C28H48F6O6 |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | bis(1,1,1-trifluoro-2-hydroxy-2,6-dimethylheptan-4-yl) 2-ethyl-2,4,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OC(CC(C)C)CC(C)(O)C(F)(F)F)C(=O)OC(CC(C)C)CC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C28H48F6O6/c1-11-24(8,22(36)40-20(13-18(4)5)15-26(10,38)28(32,33)34)16-23(6,7)21(35)39-19(12-17(2)3)14-25(9,37)27(29,30)31/h17-20,37-38H,11-16H2,1-10H3 |
| InChIKey | RNXPORDGDCTXRD-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |