C13H20F2O4 — CID 89308639
2,2-difluoropropyl 4-methyl-2-(2-methylprop-2-enoyloxy)pentanoate (PubChem CID 89308639) has the molecular formula C13H20F2O4 and a molecular weight of 278.30 g/mol. Its IUPAC name is 2,2-difluoropropyl 4-methyl-2-(2-methylprop-2-enoyloxy)pentanoate.
| Compound Name | 2,2-difluoropropyl 4-methyl-2-(2-methylprop-2-enoyloxy)pentanoate |
|---|---|
| PubChem CID | 89308639 |
| Molecular Formula | C13H20F2O4 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2,2-difluoropropyl 4-methyl-2-(2-methylprop-2-enoyloxy)pentanoate |
| SMILES | C=C(C)C(=O)OC(CC(C)C)C(=O)OCC(C)(F)F |
| InChI | InChI=1S/C13H20F2O4/c1-8(2)6-10(19-11(16)9(3)4)12(17)18-7-13(5,14)15/h8,10H,3,6-7H2,1-2,4-5H3 |
| InChIKey | JXGUMUBJHZPJSI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|