C26H40F6O8 — CID 87413828
[1,1,1,9,9,9-hexafluoro-2,4,8-trimethyl-2,8-bis[(2-methylpropan-2-yl)oxycarbonyloxy]nonan-5-yl] 2-methylprop-2-enoate (PubChem CID 87413828) has the molecular formula C26H40F6O8 and a molecular weight of 594.59 g/mol. Its IUPAC name is [1,1,1,9,9,9-hexafluoro-2,4,8-trimethyl-2,8-bis[(2-methylpropan-2-yl)oxycarbonyloxy]nonan-5-yl] 2-methylprop-2-enoate.
| Compound Name | [1,1,1,9,9,9-hexafluoro-2,4,8-trimethyl-2,8-bis[(2-methylpropan-2-yl)oxycarbonyloxy]nonan-5-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87413828 |
| Molecular Formula | C26H40F6O8 |
| Molecular Weight | 594.59 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | [1,1,1,9,9,9-hexafluoro-2,4,8-trimethyl-2,8-bis[(2-methylpropan-2-yl)oxycarbonyloxy]nonan-5-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCC(C)(OC(=O)OC(C)(C)C)C(F)(F)F)C(C)CC(C)(OC(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C26H40F6O8/c1-15(2)18(33)36-17(12-13-23(10,25(27,28)29)39-19(34)37-21(4,5)6)16(3)14-24(11,26(30,31)32)40-20(35)38-22(7,8)9/h16-17H,1,12-14H2,2-11H3 |
| InChIKey | FQUDJWHFBAWVRI-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.59 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|