C14H18F8O7S — CID 58491393
1,1,3,3,3-pentafluoro-2-[[1,1,1-trifluoro-2-methyl-4-(2-methylprop-2-enoyloxy)pentan-2-yl]oxymethoxy]propane-1-sulfonic acid (PubChem CID 58491393) has the molecular formula C14H18F8O7S and a molecular weight of 482.34 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-[[1,1,1-trifluoro-2-methyl-4-(2-methylprop-2-enoyloxy)pentan-2-yl]oxymethoxy]propane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-[[1,1,1-trifluoro-2-methyl-4-(2-methylprop-2-enoyloxy)pentan-2-yl]oxymethoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 58491393 |
| Molecular Formula | C14H18F8O7S |
| Molecular Weight | 482.34 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-[[1,1,1-trifluoro-2-methyl-4-(2-methylprop-2-enoyloxy)pentan-2-yl]oxymethoxy]propane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)OC(C)CC(C)(OCOC(C(F)(F)F)C(F)(F)S(=O)(=O)O)C(F)(F)F |
| InChI | InChI=1S/C14H18F8O7S/c1-7(2)9(23)29-8(3)5-11(4,14(20,21)22)28-6-27-10(12(15,16)17)13(18,19)30(24,25)26/h8,10H,1,5-6H2,2-4H3,(H,24,25,26) |
| InChIKey | JOELTKHKABGWIN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|