C8H12F2O5S — CID 160696452
(1,1-difluoro-1-methoxysulfonylpropan-2-yl) 2-methylprop-2-enoate (PubChem CID 160696452) has the molecular formula C8H12F2O5S and a molecular weight of 258.24 g/mol. Its IUPAC name is (1,1-difluoro-1-methoxysulfonylpropan-2-yl) 2-methylprop-2-enoate.
| Compound Name | (1,1-difluoro-1-methoxysulfonylpropan-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 160696452 |
| Molecular Formula | C8H12F2O5S |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | (1,1-difluoro-1-methoxysulfonylpropan-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)C(F)(F)S(=O)(=O)OC |
| InChI | InChI=1S/C8H12F2O5S/c1-5(2)7(11)15-6(3)8(9,10)16(12,13)14-4/h6H,1H2,2-4H3 |
| InChIKey | NCHAHEWMCWFRIP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|