About azane;(3-chloro-3-methylbutan-2-yl) 2-methylprop-2-enoate
azane;(3-chloro-3-methylbutan-2-yl) 2-methylprop-2-enoate (PubChem CID 87146988) has the molecular formula C9H18ClNO2
and a molecular weight of 207.70 g/mol. Its IUPAC name is azane;(3-chloro-3-methylbutan-2-yl) 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | azane;(3-chloro-3-methylbutan-2-yl) 2-methylprop-2-enoate |
| PubChem CID | 87146988 |
| Molecular Formula | C9H18ClNO2 |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | azane;(3-chloro-3-methylbutan-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)C(C)(C)Cl.N |
| InChI | InChI=1S/C9H15ClO2.H3N/c1-6(2)8(11)12-7(3)9(4,5)10;/h7H,1H2,2-5H3;1H3 |
| InChIKey | GDPOOQFMNNLMGB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;(3-chloro-3-methylbutan-2-yl) 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(3-chloro-3-methylbutan-2-yl) 2-methylprop-2-enoate?
The IUPAC name of azane;(3-chloro-3-methylbutan-2-yl) 2-methylprop-2-enoate (CID 87146988) is azane;(3-chloro-3-methylbutan-2-yl) 2-methylprop-2-enoate.
What is the SMILES notation for azane;(3-chloro-3-methylbutan-2-yl) 2-methylprop-2-enoate?
The canonical SMILES for azane;(3-chloro-3-methylbutan-2-yl) 2-methylprop-2-enoate is C=C(C)C(=O)OC(C)C(C)(C)Cl.N.
What is the InChIKey of azane;(3-chloro-3-methylbutan-2-yl) 2-methylprop-2-enoate?
The InChIKey is GDPOOQFMNNLMGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClO2.H3N/c1-6(2)8(11)12-7(3)9(4,5)10;/h7H,1H2,2-5H3;1H3.
What are the key properties of azane;(3-chloro-3-methylbutan-2-yl) 2-methylprop-2-enoate?
azane;(3-chloro-3-methylbutan-2-yl) 2-methylprop-2-enoate has a molecular weight of 207.70 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(3-chloro-3-methylbutan-2-yl) 2-methylprop-2-enoate is sourced from PubChem (CID 87146988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).