C12H24ClNO2 — CID 87147317
azane;(4-chloro-4-ethylhexan-3-yl) 2-methylprop-2-enoate (PubChem CID 87147317) has the molecular formula C12H24ClNO2 and a molecular weight of 249.78 g/mol. Its IUPAC name is azane;(4-chloro-4-ethylhexan-3-yl) 2-methylprop-2-enoate.
| Compound Name | azane;(4-chloro-4-ethylhexan-3-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87147317 |
| Molecular Formula | C12H24ClNO2 |
| Molecular Weight | 249.78 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | azane;(4-chloro-4-ethylhexan-3-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC)C(Cl)(CC)CC.N |
| InChI | InChI=1S/C12H21ClO2.H3N/c1-6-10(12(13,7-2)8-3)15-11(14)9(4)5;/h10H,4,6-8H2,1-3,5H3;1H3 |
| InChIKey | REMDSFNPPHZHCQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.78 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|