About 2-O-(4-chloro-4-ethylhexan-3-yl) 1-O-methyl oxalate
2-O-(4-chloro-4-ethylhexan-3-yl) 1-O-methyl oxalate (PubChem CID 174913929) has the molecular formula C11H19ClO4
and a molecular weight of 250.72 g/mol. Its IUPAC name is 2-O-(4-chloro-4-ethylhexan-3-yl) 1-O-methyl oxalate.
Molecular Properties
| Compound Name | 2-O-(4-chloro-4-ethylhexan-3-yl) 1-O-methyl oxalate |
| PubChem CID | 174913929 |
| Molecular Formula | C11H19ClO4 |
| Molecular Weight | 250.72 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-O-(4-chloro-4-ethylhexan-3-yl) 1-O-methyl oxalate |
| SMILES | CCC(OC(=O)C(=O)OC)C(Cl)(CC)CC |
| InChI | InChI=1S/C11H19ClO4/c1-5-8(11(12,6-2)7-3)16-10(14)9(13)15-4/h8H,5-7H2,1-4H3 |
| InChIKey | PCDZZVYWHIJBOP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.72 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-O-(4-chloro-4-ethylhexan-3-yl) 1-O-methyl oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-(4-chloro-4-ethylhexan-3-yl) 1-O-methyl oxalate?
The IUPAC name of 2-O-(4-chloro-4-ethylhexan-3-yl) 1-O-methyl oxalate (CID 174913929) is 2-O-(4-chloro-4-ethylhexan-3-yl) 1-O-methyl oxalate.
What is the SMILES notation for 2-O-(4-chloro-4-ethylhexan-3-yl) 1-O-methyl oxalate?
The canonical SMILES for 2-O-(4-chloro-4-ethylhexan-3-yl) 1-O-methyl oxalate is CCC(OC(=O)C(=O)OC)C(Cl)(CC)CC.
What is the InChIKey of 2-O-(4-chloro-4-ethylhexan-3-yl) 1-O-methyl oxalate?
The InChIKey is PCDZZVYWHIJBOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19ClO4/c1-5-8(11(12,6-2)7-3)16-10(14)9(13)15-4/h8H,5-7H2,1-4H3.
What are the key properties of 2-O-(4-chloro-4-ethylhexan-3-yl) 1-O-methyl oxalate?
2-O-(4-chloro-4-ethylhexan-3-yl) 1-O-methyl oxalate has a molecular weight of 250.72 g/mol, XLogP of 2.28, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-(4-chloro-4-ethylhexan-3-yl) 1-O-methyl oxalate is sourced from PubChem (CID 174913929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).