C12H14F6O4 — CID 118548748
[2-acetyloxy-1,1,1-trifluoro-2-(trifluoromethyl)pentan-3-yl] 2-methylprop-2-enoate (PubChem CID 118548748) has the molecular formula C12H14F6O4 and a molecular weight of 336.23 g/mol. Its IUPAC name is [2-acetyloxy-1,1,1-trifluoro-2-(trifluoromethyl)pentan-3-yl] 2-methylprop-2-enoate.
| Compound Name | [2-acetyloxy-1,1,1-trifluoro-2-(trifluoromethyl)pentan-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118548748 |
| Molecular Formula | C12H14F6O4 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | [2-acetyloxy-1,1,1-trifluoro-2-(trifluoromethyl)pentan-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC)C(OC(C)=O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H14F6O4/c1-5-8(21-9(20)6(2)3)10(11(13,14)15,12(16,17)18)22-7(4)19/h8H,2,5H2,1,3-4H3 |
| InChIKey | GTULDPQEHHAGDS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|