C11H16F2O3 — CID 152616428
(4,4-difluoro-5-oxoheptan-3-yl) 2-methylprop-2-enoate (PubChem CID 152616428) has the molecular formula C11H16F2O3 and a molecular weight of 234.24 g/mol. Its IUPAC name is (4,4-difluoro-5-oxoheptan-3-yl) 2-methylprop-2-enoate.
| Compound Name | (4,4-difluoro-5-oxoheptan-3-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 152616428 |
| Molecular Formula | C11H16F2O3 |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | (4,4-difluoro-5-oxoheptan-3-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC)C(F)(F)C(=O)CC |
| InChI | InChI=1S/C11H16F2O3/c1-5-8(14)11(12,13)9(6-2)16-10(15)7(3)4/h9H,3,5-6H2,1-2,4H3 |
| InChIKey | ZAPIXULKWSIDGM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|