C13H20F2O4 — CID 86663489
butyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate (PubChem CID 86663489) has the molecular formula C13H20F2O4 and a molecular weight of 278.29 g/mol. Its IUPAC name is butyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate.
| Compound Name | butyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate |
|---|---|
| PubChem CID | 86663489 |
| Molecular Formula | C13H20F2O4 |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | butyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate |
| SMILES | C=C(C)C(=O)OC(CC)C(F)(F)C(=O)OCCCC |
| InChI | InChI=1S/C13H20F2O4/c1-5-7-8-18-12(17)13(14,15)10(6-2)19-11(16)9(3)4/h10H,3,5-8H2,1-2,4H3 |
| InChIKey | ZMSXJEIAESIHIS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|