butyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate

C13H20F2O4 — CID 86663489

IUPACbutyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate
SMILESC=C(C)C(=O)OC(CC)C(F)(F)C(=O)OCCCC
InChIInChI=1S/C13H20F2O4/c1-5-7-8-18-12(17)13(14,15)10(6-2)19-11(16)9(3)4/h10H,3,5-8H2,1-2,4H3
InChIKeyZMSXJEIAESIHIS-UHFFFAOYSA-N
MW278.29 g/mol
LogP2.86
Rot. Bonds8

About butyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate

butyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate (PubChem CID 86663489) has the molecular formula C13H20F2O4 and a molecular weight of 278.29 g/mol. Its IUPAC name is butyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate.

Molecular Properties

Compound Namebutyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate
PubChem CID86663489
Molecular FormulaC13H20F2O4
Molecular Weight278.29 g/mol
Exact Mass278.13
IUPAC Namebutyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate
SMILESC=C(C)C(=O)OC(CC)C(F)(F)C(=O)OCCCC
InChIInChI=1S/C13H20F2O4/c1-5-7-8-18-12(17)13(14,15)10(6-2)19-11(16)9(3)4/h10H,3,5-8H2,1-2,4H3
InChIKeyZMSXJEIAESIHIS-UHFFFAOYSA-N
XLogP2.86
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.29
LogP ≤ 52.86
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze butyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate?
The IUPAC name of butyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate (CID 86663489) is butyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate.
What is the SMILES notation for butyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate?
The canonical SMILES for butyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate is C=C(C)C(=O)OC(CC)C(F)(F)C(=O)OCCCC.
What is the InChIKey of butyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate?
The InChIKey is ZMSXJEIAESIHIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F2O4/c1-5-7-8-18-12(17)13(14,15)10(6-2)19-11(16)9(3)4/h10H,3,5-8H2,1-2,4H3.
What are the key properties of butyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate?
butyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate has a molecular weight of 278.29 g/mol, XLogP of 2.86, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate is sourced from PubChem (CID 86663489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).