C16H25F5O4 — CID 118257807
[2,2-difluoro-1-oxo-1-(5,5,5-trifluoropentoxy)pentan-3-yl] 2,2-dimethylbutanoate (PubChem CID 118257807) has the molecular formula C16H25F5O4 and a molecular weight of 376.36 g/mol. Its IUPAC name is [2,2-difluoro-1-oxo-1-(5,5,5-trifluoropentoxy)pentan-3-yl] 2,2-dimethylbutanoate.
| Compound Name | [2,2-difluoro-1-oxo-1-(5,5,5-trifluoropentoxy)pentan-3-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 118257807 |
| Molecular Formula | C16H25F5O4 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [2,2-difluoro-1-oxo-1-(5,5,5-trifluoropentoxy)pentan-3-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(OC(=O)C(C)(C)CC)C(F)(F)C(=O)OCCCCC(F)(F)F |
| InChI | InChI=1S/C16H25F5O4/c1-5-11(25-12(22)14(3,4)6-2)16(20,21)13(23)24-10-8-7-9-15(17,18)19/h11H,5-10H2,1-4H3 |
| InChIKey | OJALANSDZDZYOA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|