C29H44F6O12 — CID 123520350
4-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 1-O-(3,3,3-trifluoropropyl) butanedioate;4-O-[2-(2-methylbutanoyloxy)ethyl] 1-O-(3,3,3-trifluoropropyl) butanedioate (PubChem CID 123520350) has the molecular formula C29H44F6O12 and a molecular weight of 698.65 g/mol. Its IUPAC name is 4-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 1-O-(3,3,3-trifluoropropyl) butanedioate;4-O-[2-(2-methylbutanoyloxy)ethyl] 1-O-(3,3,3-trifluoropropyl) butanedioate.
| Compound Name | 4-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 1-O-(3,3,3-trifluoropropyl) butanedioate;4-O-[2-(2-methylbutanoyloxy)ethyl] 1-O-(3,3,3-trifluoropropyl) butanedioate |
|---|---|
| PubChem CID | 123520350 |
| Molecular Formula | C29H44F6O12 |
| Molecular Weight | 698.65 g/mol |
| Exact Mass | 698.27 |
| IUPAC Name | 4-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 1-O-(3,3,3-trifluoropropyl) butanedioate;4-O-[2-(2-methylbutanoyloxy)ethyl] 1-O-(3,3,3-trifluoropropyl) butanedioate |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)CCC(=O)OCCC(F)(F)F.CCC(C)C(=O)OCCOC(=O)CCC(=O)OCCC(F)(F)F |
| InChI | InChI=1S/C15H23F3O6.C14H21F3O6/c1-4-14(2,3)13(21)24-10-9-23-12(20)6-5-11(19)22-8-7-15(16,17)18;1-3-10(2)13(20)23-9-8-22-12(19)5-4-11(18)21-7-6-14(15,16)17/h4-10H2,1-3H3;10H,3-9H2,1-2H3 |
| InChIKey | DVVYPQDRVWEOSR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.65 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|