C27H47F3O7 — CID 160550362
6-O-[3-(2,2-dimethylbutanoyloxy)propyl] 1-O-methyl 2-methylhexanedioate;8,8,8-trifluoro-3,3-dimethyloctan-4-one (PubChem CID 160550362) has the molecular formula C27H47F3O7 and a molecular weight of 540.66 g/mol. Its IUPAC name is 6-O-[3-(2,2-dimethylbutanoyloxy)propyl] 1-O-methyl 2-methylhexanedioate;8,8,8-trifluoro-3,3-dimethyloctan-4-one.
| Compound Name | 6-O-[3-(2,2-dimethylbutanoyloxy)propyl] 1-O-methyl 2-methylhexanedioate;8,8,8-trifluoro-3,3-dimethyloctan-4-one |
|---|---|
| PubChem CID | 160550362 |
| Molecular Formula | C27H47F3O7 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | 6-O-[3-(2,2-dimethylbutanoyloxy)propyl] 1-O-methyl 2-methylhexanedioate;8,8,8-trifluoro-3,3-dimethyloctan-4-one |
| SMILES | CCC(C)(C)C(=O)CCCC(F)(F)F.CCC(C)(C)C(=O)OCCCOC(=O)CCCC(C)C(=O)OC |
| InChI | InChI=1S/C17H30O6.C10H17F3O/c1-6-17(3,4)16(20)23-12-8-11-22-14(18)10-7-9-13(2)15(19)21-5;1-4-9(2,3)8(14)6-5-7-10(11,12)13/h13H,6-12H2,1-5H3;4-7H2,1-3H3 |
| InChIKey | QXZFYCQFXBVMGO-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|