C20H38F2O6 — CID 161331937
1-O-[4-(2,2-dimethylbutanoyloxy)butyl] 5-O-propan-2-yl 3,3-difluoropentanedioate;methane (PubChem CID 161331937) has the molecular formula C20H38F2O6 and a molecular weight of 412.51 g/mol. Its IUPAC name is 1-O-[4-(2,2-dimethylbutanoyloxy)butyl] 5-O-propan-2-yl 3,3-difluoropentanedioate;methane.
| Compound Name | 1-O-[4-(2,2-dimethylbutanoyloxy)butyl] 5-O-propan-2-yl 3,3-difluoropentanedioate;methane |
|---|---|
| PubChem CID | 161331937 |
| Molecular Formula | C20H38F2O6 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 1-O-[4-(2,2-dimethylbutanoyloxy)butyl] 5-O-propan-2-yl 3,3-difluoropentanedioate;methane |
| SMILES | C.C.CCC(C)(C)C(=O)OCCCCOC(=O)CC(F)(F)CC(=O)OC(C)C |
| InChI | InChI=1S/C18H30F2O6.2CH4/c1-6-17(4,5)16(23)25-10-8-7-9-24-14(21)11-18(19,20)12-15(22)26-13(2)3;;/h13H,6-12H2,1-5H3;2*1H4 |
| InChIKey | VLNLMZNPVXPLPD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|