C17H24F6O5 — CID 89254618
2-(2,2-dimethylbutanoyloxy)ethyl 3,3,5,5,7,7-hexafluoro-8-oxononanoate (PubChem CID 89254618) has the molecular formula C17H24F6O5 and a molecular weight of 422.36 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxy)ethyl 3,3,5,5,7,7-hexafluoro-8-oxononanoate.
| Compound Name | 2-(2,2-dimethylbutanoyloxy)ethyl 3,3,5,5,7,7-hexafluoro-8-oxononanoate |
|---|---|
| PubChem CID | 89254618 |
| Molecular Formula | C17H24F6O5 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxy)ethyl 3,3,5,5,7,7-hexafluoro-8-oxononanoate |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)CC(F)(F)CC(F)(F)CC(F)(F)C(C)=O |
| InChI | InChI=1S/C17H24F6O5/c1-5-14(3,4)13(26)28-7-6-27-12(25)8-15(18,19)9-16(20,21)10-17(22,23)11(2)24/h5-10H2,1-4H3 |
| InChIKey | QZHQOSFYQLHKNA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|