(1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate

C8H14Cl2O2Si — CID 173234354

IUPAC(1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate
SMILESC=C(C)C(=O)OC(CC)C([SiH3])(Cl)Cl
InChIInChI=1S/C8H14Cl2O2Si/c1-4-6(8(9,10)13)12-7(11)5(2)3/h6H,2,4H2,1,3,13H3
InChIKeyLZDPRKJSUPLNMU-UHFFFAOYSA-N
MW241.19 g/mol
LogP1.38
Rot. Bonds4

About (1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate

(1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate (PubChem CID 173234354) has the molecular formula C8H14Cl2O2Si and a molecular weight of 241.19 g/mol. Its IUPAC name is (1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate.

Molecular Properties

Compound Name(1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate
PubChem CID173234354
Molecular FormulaC8H14Cl2O2Si
Molecular Weight241.19 g/mol
Exact Mass240.01
IUPAC Name(1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate
SMILESC=C(C)C(=O)OC(CC)C([SiH3])(Cl)Cl
InChIInChI=1S/C8H14Cl2O2Si/c1-4-6(8(9,10)13)12-7(11)5(2)3/h6H,2,4H2,1,3,13H3
InChIKeyLZDPRKJSUPLNMU-UHFFFAOYSA-N
XLogP1.38
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.19
LogP ≤ 51.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate?
The IUPAC name of (1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate (CID 173234354) is (1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate.
What is the SMILES notation for (1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate?
The canonical SMILES for (1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate is C=C(C)C(=O)OC(CC)C([SiH3])(Cl)Cl.
What is the InChIKey of (1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate?
The InChIKey is LZDPRKJSUPLNMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14Cl2O2Si/c1-4-6(8(9,10)13)12-7(11)5(2)3/h6H,2,4H2,1,3,13H3.
What are the key properties of (1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate?
(1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate has a molecular weight of 241.19 g/mol, XLogP of 1.38, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate is sourced from PubChem (CID 173234354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).