C8H14Cl2O2Si — CID 173234354
(1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate (PubChem CID 173234354) has the molecular formula C8H14Cl2O2Si and a molecular weight of 241.19 g/mol. Its IUPAC name is (1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate.
| Compound Name | (1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 173234354 |
| Molecular Formula | C8H14Cl2O2Si |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | (1,1-dichloro-1-silylbutan-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC)C([SiH3])(Cl)Cl |
| InChI | InChI=1S/C8H14Cl2O2Si/c1-4-6(8(9,10)13)12-7(11)5(2)3/h6H,2,4H2,1,3,13H3 |
| InChIKey | LZDPRKJSUPLNMU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|