C20H34O6 — CID 88658910
[1-[3,3-dimethyl-2-(2-methylprop-2-enoyloxy)butyl]peroxy-3,3-dimethylbutan-2-yl] 2-methylprop-2-enoate (PubChem CID 88658910) has the molecular formula C20H34O6 and a molecular weight of 370.49 g/mol. Its IUPAC name is [1-[3,3-dimethyl-2-(2-methylprop-2-enoyloxy)butyl]peroxy-3,3-dimethylbutan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-[3,3-dimethyl-2-(2-methylprop-2-enoyloxy)butyl]peroxy-3,3-dimethylbutan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88658910 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | [1-[3,3-dimethyl-2-(2-methylprop-2-enoyloxy)butyl]peroxy-3,3-dimethylbutan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(COOCC(OC(=O)C(=C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H34O6/c1-13(2)17(21)25-15(19(5,6)7)11-23-24-12-16(20(8,9)10)26-18(22)14(3)4/h15-16H,1,3,11-12H2,2,4-10H3 |
| InChIKey | PVSZNZSELIRDLT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|