C11H21NO2 — CID 91213887
[3-methyl-3-(methylamino)pentan-2-yl] 2-methylprop-2-enoate (PubChem CID 91213887) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is [3-methyl-3-(methylamino)pentan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [3-methyl-3-(methylamino)pentan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 91213887 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | [3-methyl-3-(methylamino)pentan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)C(C)(CC)NC |
| InChI | InChI=1S/C11H21NO2/c1-7-11(5,12-6)9(4)14-10(13)8(2)3/h9,12H,2,7H2,1,3-6H3 |
| InChIKey | SOXPLKAVBGDTRH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|