C12H23NO4 — CID 139878668
1-(1,1-diethoxyethylamino)ethyl 2-methylprop-2-enoate (PubChem CID 139878668) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is 1-(1,1-diethoxyethylamino)ethyl 2-methylprop-2-enoate.
| Compound Name | 1-(1,1-diethoxyethylamino)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139878668 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 1-(1,1-diethoxyethylamino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)NC(C)(OCC)OCC |
| InChI | InChI=1S/C12H23NO4/c1-7-15-12(6,16-8-2)13-10(5)17-11(14)9(3)4/h10,13H,3,7-8H2,1-2,4-6H3 |
| InChIKey | DFWXLWQXJTUMTM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|