C12H23NO6 — CID 174490728
1-(ethoxycarbonylamino)ethyl 2-methylprop-2-enoate;propane-1,2-diol (PubChem CID 174490728) has the molecular formula C12H23NO6 and a molecular weight of 277.32 g/mol. Its IUPAC name is 1-(ethoxycarbonylamino)ethyl 2-methylprop-2-enoate;propane-1,2-diol.
| Compound Name | 1-(ethoxycarbonylamino)ethyl 2-methylprop-2-enoate;propane-1,2-diol |
|---|---|
| PubChem CID | 174490728 |
| Molecular Formula | C12H23NO6 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 1-(ethoxycarbonylamino)ethyl 2-methylprop-2-enoate;propane-1,2-diol |
| SMILES | C=C(C)C(=O)OC(C)NC(=O)OCC.CC(O)CO |
| InChI | InChI=1S/C9H15NO4.C3H8O2/c1-5-13-9(12)10-7(4)14-8(11)6(2)3;1-3(5)2-4/h7H,2,5H2,1,3-4H3,(H,10,12);3-5H,2H2,1H3 |
| InChIKey | WCIOKHBNHICWEH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|