C14H13F5O5S — CID 158215988
(1,1,1,3,3-pentafluoro-3-methoxysulfonylpropan-2-yl) 4-prop-1-en-2-ylbenzoate (PubChem CID 158215988) has the molecular formula C14H13F5O5S and a molecular weight of 388.31 g/mol. Its IUPAC name is (1,1,1,3,3-pentafluoro-3-methoxysulfonylpropan-2-yl) 4-prop-1-en-2-ylbenzoate.
| Compound Name | (1,1,1,3,3-pentafluoro-3-methoxysulfonylpropan-2-yl) 4-prop-1-en-2-ylbenzoate |
|---|---|
| PubChem CID | 158215988 |
| Molecular Formula | C14H13F5O5S |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | (1,1,1,3,3-pentafluoro-3-methoxysulfonylpropan-2-yl) 4-prop-1-en-2-ylbenzoate |
| SMILES | C=C(C)c1ccc(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)OC)cc1 |
| InChI | InChI=1S/C14H13F5O5S/c1-8(2)9-4-6-10(7-5-9)11(20)24-12(13(15,16)17)14(18,19)25(21,22)23-3/h4-7,12H,1H2,2-3H3 |
| InChIKey | CQIDMGCJYZGYDA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|