C10H6F5IO6S — CID 129070798
1,1,3,3,3-pentafluoro-2-(3-hydroxy-4-iodobenzoyl)oxypropane-1-sulfonic acid (PubChem CID 129070798) has the molecular formula C10H6F5IO6S and a molecular weight of 476.11 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-(3-hydroxy-4-iodobenzoyl)oxypropane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-(3-hydroxy-4-iodobenzoyl)oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 129070798 |
| Molecular Formula | C10H6F5IO6S |
| Molecular Weight | 476.11 g/mol |
| Exact Mass | 475.88 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-(3-hydroxy-4-iodobenzoyl)oxypropane-1-sulfonic acid |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)c1ccc(I)c(O)c1 |
| InChI | InChI=1S/C10H6F5IO6S/c11-9(12,13)8(10(14,15)23(19,20)21)22-7(18)4-1-2-5(16)6(17)3-4/h1-3,8,17H,(H,19,20,21) |
| InChIKey | QGEACCVVBWZXFR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.11 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|