C14H11F5O5S — CID 123871920
2-(7,8-dihydronaphthalene-2-carbonyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonic acid (PubChem CID 123871920) has the molecular formula C14H11F5O5S and a molecular weight of 386.29 g/mol. Its IUPAC name is 2-(7,8-dihydronaphthalene-2-carbonyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonic acid.
| Compound Name | 2-(7,8-dihydronaphthalene-2-carbonyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 123871920 |
| Molecular Formula | C14H11F5O5S |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 2-(7,8-dihydronaphthalene-2-carbonyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)c1ccc2c(c1)CCC=C2 |
| InChI | InChI=1S/C14H11F5O5S/c15-13(16,17)12(14(18,19)25(21,22)23)24-11(20)10-6-5-8-3-1-2-4-9(8)7-10/h1,3,5-7,12H,2,4H2,(H,21,22,23) |
| InChIKey | DPDHPRVSNHQGOW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|