C11H8BF5O6S — CID 160589288
CID 160589288 (PubChem CID 160589288) has the molecular formula C11H8BF5O6S and a molecular weight of 374.05 g/mol.
| Compound Name | CID 160589288 |
|---|---|
| PubChem CID | 160589288 |
| Molecular Formula | C11H8BF5O6S |
| Molecular Weight | 374.05 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | — |
| SMILES | [B]Cc1ccc(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)c(O)c1 |
| InChI | InChI=1S/C11H8BF5O6S/c12-4-5-1-2-6(7(18)3-5)8(19)23-9(10(13,14)15)11(16,17)24(20,21)22/h1-3,9,18H,4H2,(H,20,21,22) |
| InChIKey | LEYBJJKZQHTGJZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.05 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|