C13H13BF2O7S — CID 167638044
CID 167638044 (PubChem CID 167638044) has the molecular formula C13H13BF2O7S and a molecular weight of 362.12 g/mol.
| Compound Name | CID 167638044 |
|---|---|
| PubChem CID | 167638044 |
| Molecular Formula | C13H13BF2O7S |
| Molecular Weight | 362.12 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | — |
| SMILES | [B]Cc1ccc(C(=O)OCC(F)(F)S(=O)(=O)O)c(OC(=O)CC)c1 |
| InChI | InChI=1S/C13H13BF2O7S/c1-2-11(17)23-10-5-8(6-14)3-4-9(10)12(18)22-7-13(15,16)24(19,20)21/h3-5H,2,6-7H2,1H3,(H,19,20,21) |
| InChIKey | NDCNJWXLGOPZGM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.12 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|