About CID 157139059
CID 157139059 (PubChem CID 157139059) has the molecular formula C12H13BO7S
and a molecular weight of 312.11 g/mol.
Molecular Properties
| Compound Name | CID 157139059 |
| PubChem CID | 157139059 |
| Molecular Formula | C12H13BO7S |
| Molecular Weight | 312.11 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | — |
| SMILES | [B]Cc1ccc(C(=O)OCCS(=O)(=O)O)c(OC(C)=O)c1 |
| InChI | InChI=1S/C12H13BO7S/c1-8(14)20-11-6-9(7-13)2-3-10(11)12(15)19-4-5-21(16,17)18/h2-3,6H,4-5,7H2,1H3,(H,16,17,18) |
| InChIKey | RQHWNMKISFMQAE-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.11 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 157139059 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157139059?
The IUPAC name of CID 157139059 (CID 157139059) is not available.
What is the SMILES notation for CID 157139059?
The canonical SMILES for CID 157139059 is [B]Cc1ccc(C(=O)OCCS(=O)(=O)O)c(OC(C)=O)c1.
What is the InChIKey of CID 157139059?
The InChIKey is RQHWNMKISFMQAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BO7S/c1-8(14)20-11-6-9(7-13)2-3-10(11)12(15)19-4-5-21(16,17)18/h2-3,6H,4-5,7H2,1H3,(H,16,17,18).
What are the key properties of CID 157139059?
CID 157139059 has a molecular weight of 312.11 g/mol, XLogP of 0.32, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157139059 is sourced from PubChem (CID 157139059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).