About CID 157414187
CID 157414187 (PubChem CID 157414187) has the molecular formula C10H10BClO5S
and a molecular weight of 288.52 g/mol.
Molecular Properties
| Compound Name | CID 157414187 |
| PubChem CID | 157414187 |
| Molecular Formula | C10H10BClO5S |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | — |
| SMILES | [B]Cc1ccc(Cl)c(C(=O)OCCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C10H10BClO5S/c11-6-7-1-2-9(12)8(5-7)10(13)17-3-4-18(14,15)16/h1-2,5H,3-4,6H2,(H,14,15,16) |
| InChIKey | UWHFEDHNDMYDBF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 157414187 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157414187?
The IUPAC name of CID 157414187 (CID 157414187) is not available.
What is the SMILES notation for CID 157414187?
The canonical SMILES for CID 157414187 is [B]Cc1ccc(Cl)c(C(=O)OCCS(=O)(=O)O)c1.
What is the InChIKey of CID 157414187?
The InChIKey is UWHFEDHNDMYDBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BClO5S/c11-6-7-1-2-9(12)8(5-7)10(13)17-3-4-18(14,15)16/h1-2,5H,3-4,6H2,(H,14,15,16).
What are the key properties of CID 157414187?
CID 157414187 has a molecular weight of 288.52 g/mol, XLogP of 1.05, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157414187 is sourced from PubChem (CID 157414187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).