C16H12F5I3O8S — CID 176641519
1,1,3,3,3-pentafluoro-2-[2,4,5-triiodo-3-[2-(2-methylprop-2-enoyloxy)ethoxy]benzoyl]oxypropane-1-sulfonic acid (PubChem CID 176641519) has the molecular formula C16H12F5I3O8S and a molecular weight of 840.03 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-[2,4,5-triiodo-3-[2-(2-methylprop-2-enoyloxy)ethoxy]benzoyl]oxypropane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-[2,4,5-triiodo-3-[2-(2-methylprop-2-enoyloxy)ethoxy]benzoyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 176641519 |
| Molecular Formula | C16H12F5I3O8S |
| Molecular Weight | 840.03 g/mol |
| Exact Mass | 839.73 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-[2,4,5-triiodo-3-[2-(2-methylprop-2-enoyloxy)ethoxy]benzoyl]oxypropane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)OCCOc1c(I)c(I)cc(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)c1I |
| InChI | InChI=1S/C16H12F5I3O8S/c1-6(2)12(25)31-4-3-30-11-9(23)7(5-8(22)10(11)24)13(26)32-14(15(17,18)19)16(20,21)33(27,28)29/h5,14H,1,3-4H2,2H3,(H,27,28,29) |
| InChIKey | SSCLNLFKOTZTFR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.03 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|