C20H23F5O5 — CID 170402377
1,1,1,3,3-pentafluorobutan-2-yl 3-methyl-4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoate (PubChem CID 170402377) has the molecular formula C20H23F5O5 and a molecular weight of 438.39 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluorobutan-2-yl 3-methyl-4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoate.
| Compound Name | 1,1,1,3,3-pentafluorobutan-2-yl 3-methyl-4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoate |
|---|---|
| PubChem CID | 170402377 |
| Molecular Formula | C20H23F5O5 |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 1,1,1,3,3-pentafluorobutan-2-yl 3-methyl-4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCCCOc1ccc(C(=O)OC(C(C)(F)F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C20H23F5O5/c1-12(2)16(26)29-10-6-5-9-28-15-8-7-14(11-13(15)3)17(27)30-18(19(4,21)22)20(23,24)25/h7-8,11,18H,1,5-6,9-10H2,2-4H3 |
| InChIKey | ZROHSNRDNZAVLY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|