C24H28F5IO7S — CID 171598031
1,1,3,3,3-pentafluoro-2-[4-iodo-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxypropane-1-sulfonic acid (PubChem CID 171598031) has the molecular formula C24H28F5IO7S and a molecular weight of 682.44 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-[4-iodo-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxypropane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-[4-iodo-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 171598031 |
| Molecular Formula | C24H28F5IO7S |
| Molecular Weight | 682.44 g/mol |
| Exact Mass | 682.05 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-[4-iodo-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxypropane-1-sulfonic acid |
| SMILES | CC(C)C(Oc1cc(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)ccc1I)OC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C24H28F5IO7S/c1-11(2)21(35-18-10-13-8-16(18)15-5-3-4-14(13)15)36-19-9-12(6-7-17(19)30)20(31)37-22(23(25,26)27)24(28,29)38(32,33)34/h6-7,9,11,13-16,18,21-22H,3-5,8,10H2,1-2H3,(H,32,33,34) |
| InChIKey | YEVWOQVNRSXZEO-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.44 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|