C25H35F3O2 — CID 176874113
8-[1-[5-butan-2-yl-2-(trifluoromethyl)phenoxy]-2-methylpropoxy]tricyclo[5.2.1.02,6]decane (PubChem CID 176874113) has the molecular formula C25H35F3O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 8-[1-[5-butan-2-yl-2-(trifluoromethyl)phenoxy]-2-methylpropoxy]tricyclo[5.2.1.02,6]decane.
| Compound Name | 8-[1-[5-butan-2-yl-2-(trifluoromethyl)phenoxy]-2-methylpropoxy]tricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 176874113 |
| Molecular Formula | C25H35F3O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 8-[1-[5-butan-2-yl-2-(trifluoromethyl)phenoxy]-2-methylpropoxy]tricyclo[5.2.1.02,6]decane |
| SMILES | CCC(C)c1ccc(C(F)(F)F)c(OC(OC2CC3CC2C2CCCC32)C(C)C)c1 |
| InChI | InChI=1S/C25H35F3O2/c1-5-15(4)16-9-10-21(25(26,27)28)23(12-16)30-24(14(2)3)29-22-13-17-11-20(22)19-8-6-7-18(17)19/h9-10,12,14-15,17-20,22,24H,5-8,11,13H2,1-4H3 |
| InChIKey | ZZFXHNFFOUSMPX-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|