C24H17F6O3S+ — CID 164747687
(4-acetylphenyl)-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)phenyl]-phenylsulfanium (PubChem CID 164747687) has the molecular formula C24H17F6O3S+ and a molecular weight of 499.45 g/mol. Its IUPAC name is (4-acetylphenyl)-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)phenyl]-phenylsulfanium.
| Compound Name | (4-acetylphenyl)-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)phenyl]-phenylsulfanium |
|---|---|
| PubChem CID | 164747687 |
| Molecular Formula | C24H17F6O3S+ |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | (4-acetylphenyl)-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)phenyl]-phenylsulfanium |
| SMILES | CC(=O)c1ccc([S+](c2ccccc2)c2ccc(C(=O)OC(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H17F6O3S/c1-15(31)16-7-11-19(12-8-16)34(18-5-3-2-4-6-18)20-13-9-17(10-14-20)21(32)33-22(23(25,26)27)24(28,29)30/h2-14,22H,1H3/q+1 |
| InChIKey | GNCWKCFBGMPVMS-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|