C11H11F10NO4S — CID 87530538
1-[fluoro(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propan-2-yl 2-methylprop-2-enoate (PubChem CID 87530538) has the molecular formula C11H11F10NO4S and a molecular weight of 443.26 g/mol. Its IUPAC name is 1-[fluoro(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propan-2-yl 2-methylprop-2-enoate.
| Compound Name | 1-[fluoro(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87530538 |
| Molecular Formula | C11H11F10NO4S |
| Molecular Weight | 443.26 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | 1-[fluoro(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)CN(F)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H11F10NO4S/c1-5(2)7(23)26-6(3)4-22(21)27(24,25)11(19,20)9(14,15)8(12,13)10(16,17)18/h6H,1,4H2,2-3H3 |
| InChIKey | MTRABFHZKQCDTN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|