C8H14FNO4S — CID 121329840
1-(fluoromethylsulfonylamino)propan-2-yl 2-methylprop-2-enoate (PubChem CID 121329840) has the molecular formula C8H14FNO4S and a molecular weight of 239.27 g/mol. Its IUPAC name is 1-(fluoromethylsulfonylamino)propan-2-yl 2-methylprop-2-enoate.
| Compound Name | 1-(fluoromethylsulfonylamino)propan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 121329840 |
| Molecular Formula | C8H14FNO4S |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 1-(fluoromethylsulfonylamino)propan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)CNS(=O)(=O)CF |
| InChI | InChI=1S/C8H14FNO4S/c1-6(2)8(11)14-7(3)4-10-15(12,13)5-9/h7,10H,1,4-5H2,2-3H3 |
| InChIKey | KPNOFFGZUIXQPP-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|