C11H20O5S — CID 174599714
2-methyl-5-(2-methylprop-2-enoyloxy)hexane-1-sulfonic acid (PubChem CID 174599714) has the molecular formula C11H20O5S and a molecular weight of 264.34 g/mol. Its IUPAC name is 2-methyl-5-(2-methylprop-2-enoyloxy)hexane-1-sulfonic acid.
| Compound Name | 2-methyl-5-(2-methylprop-2-enoyloxy)hexane-1-sulfonic acid |
|---|---|
| PubChem CID | 174599714 |
| Molecular Formula | C11H20O5S |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-methyl-5-(2-methylprop-2-enoyloxy)hexane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)OC(C)CCC(C)CS(=O)(=O)O |
| InChI | InChI=1S/C11H20O5S/c1-8(2)11(12)16-10(4)6-5-9(3)7-17(13,14)15/h9-10H,1,5-7H2,2-4H3,(H,13,14,15) |
| InChIKey | QQWCSLWRBCJAMN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|