C11H19N3O6 — CID 174675265
(6-amino-5-carbamoyl-6-oxohexan-2-yl) 2-methylprop-2-enoate;nitrous acid (PubChem CID 174675265) has the molecular formula C11H19N3O6 and a molecular weight of 289.29 g/mol. Its IUPAC name is (6-amino-5-carbamoyl-6-oxohexan-2-yl) 2-methylprop-2-enoate;nitrous acid.
| Compound Name | (6-amino-5-carbamoyl-6-oxohexan-2-yl) 2-methylprop-2-enoate;nitrous acid |
|---|---|
| PubChem CID | 174675265 |
| Molecular Formula | C11H19N3O6 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (6-amino-5-carbamoyl-6-oxohexan-2-yl) 2-methylprop-2-enoate;nitrous acid |
| SMILES | C=C(C)C(=O)OC(C)CCC(C(N)=O)C(N)=O.O=NO |
| InChI | InChI=1S/C11H18N2O4.HNO2/c1-6(2)11(16)17-7(3)4-5-8(9(12)14)10(13)15;2-1-3/h7-8H,1,4-5H2,2-3H3,(H2,12,14)(H2,13,15);(H,2,3) |
| InChIKey | UNUNJTSYBPUSMJ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|