About sodium;1-butoxysulfonylpropan-2-yl 2-methylprop-2-enoate;hydride
sodium;1-butoxysulfonylpropan-2-yl 2-methylprop-2-enoate;hydride (PubChem CID 174662526) has the molecular formula C11H21NaO5S
and a molecular weight of 288.34 g/mol. Its IUPAC name is sodium;1-butoxysulfonylpropan-2-yl 2-methylprop-2-enoate;hydride.
Molecular Properties
| Compound Name | sodium;1-butoxysulfonylpropan-2-yl 2-methylprop-2-enoate;hydride |
| PubChem CID | 174662526 |
| Molecular Formula | C11H21NaO5S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | sodium;1-butoxysulfonylpropan-2-yl 2-methylprop-2-enoate;hydride |
| SMILES | C=C(C)C(=O)OC(C)CS(=O)(=O)OCCCC.[H-].[Na+] |
| InChI | InChI=1S/C11H20O5S.Na.H/c1-5-6-7-15-17(13,14)8-10(4)16-11(12)9(2)3;;/h10H,2,5-8H2,1,3-4H3;;/q;+1;-1 |
| InChIKey | GJPAOOPZTKTLOE-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;1-butoxysulfonylpropan-2-yl 2-methylprop-2-enoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1-butoxysulfonylpropan-2-yl 2-methylprop-2-enoate;hydride?
The IUPAC name of sodium;1-butoxysulfonylpropan-2-yl 2-methylprop-2-enoate;hydride (CID 174662526) is sodium;1-butoxysulfonylpropan-2-yl 2-methylprop-2-enoate;hydride.
What is the SMILES notation for sodium;1-butoxysulfonylpropan-2-yl 2-methylprop-2-enoate;hydride?
The canonical SMILES for sodium;1-butoxysulfonylpropan-2-yl 2-methylprop-2-enoate;hydride is C=C(C)C(=O)OC(C)CS(=O)(=O)OCCCC.[H-].[Na+].
What is the InChIKey of sodium;1-butoxysulfonylpropan-2-yl 2-methylprop-2-enoate;hydride?
The InChIKey is GJPAOOPZTKTLOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O5S.Na.H/c1-5-6-7-15-17(13,14)8-10(4)16-11(12)9(2)3;;/h10H,2,5-8H2,1,3-4H3;;/q;+1;-1.
What are the key properties of sodium;1-butoxysulfonylpropan-2-yl 2-methylprop-2-enoate;hydride?
sodium;1-butoxysulfonylpropan-2-yl 2-methylprop-2-enoate;hydride has a molecular weight of 288.34 g/mol, XLogP of -1.24, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1-butoxysulfonylpropan-2-yl 2-methylprop-2-enoate;hydride is sourced from PubChem (CID 174662526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).