C10H8F10O3 — CID 11199384
[4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl] 2-methylprop-2-enoate (PubChem CID 11199384) has the molecular formula C10H8F10O3 and a molecular weight of 366.15 g/mol. Its IUPAC name is [4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 11199384 |
| Molecular Formula | C10H8F10O3 |
| Molecular Weight | 366.15 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | [4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C(F)(F)F)C(F)(F)C(O)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H8F10O3/c1-3(2)4(21)23-5(9(15,16)17)8(13,14)7(22,6(11)12)10(18,19)20/h5-6,22H,1H2,2H3 |
| InChIKey | JBPLNHXVLPMFIF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.15 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|