C24H37F9O6 — CID 129118756
[2,4,4,5-tetramethyl-2-(4,4,4-trifluoro-3-hydroxy-3-methylbutan-2-yl)oxy-5-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butan-2-yl]oxyhexan-3-yl] 2-methylprop-2-enoate (PubChem CID 129118756) has the molecular formula C24H37F9O6 and a molecular weight of 592.54 g/mol. Its IUPAC name is [2,4,4,5-tetramethyl-2-(4,4,4-trifluoro-3-hydroxy-3-methylbutan-2-yl)oxy-5-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butan-2-yl]oxyhexan-3-yl] 2-methylprop-2-enoate.
| Compound Name | [2,4,4,5-tetramethyl-2-(4,4,4-trifluoro-3-hydroxy-3-methylbutan-2-yl)oxy-5-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butan-2-yl]oxyhexan-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129118756 |
| Molecular Formula | C24H37F9O6 |
| Molecular Weight | 592.54 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | [2,4,4,5-tetramethyl-2-(4,4,4-trifluoro-3-hydroxy-3-methylbutan-2-yl)oxy-5-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butan-2-yl]oxyhexan-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C(C)(C)OC(C)C(C)(O)C(F)(F)F)C(C)(C)C(C)(C)OC(C)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C24H37F9O6/c1-12(2)15(34)37-16(18(7,8)38-13(3)20(11,35)22(25,26)27)17(5,6)19(9,10)39-14(4)21(36,23(28,29)30)24(31,32)33/h13-14,16,35-36H,1H2,2-11H3 |
| InChIKey | JUFOVDIUXYVNGB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.54 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|