C18H25F3O3 — CID 118360929
[1-(2-adamantyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropyl] 2-methylprop-2-enoate (PubChem CID 118360929) has the molecular formula C18H25F3O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is [1-(2-adamantyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropyl] 2-methylprop-2-enoate.
| Compound Name | [1-(2-adamantyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118360929 |
| Molecular Formula | C18H25F3O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [1-(2-adamantyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C1C2CC3CC(C2)CC1C3)C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C18H25F3O3/c1-9(2)16(22)24-15(17(3,23)18(19,20)21)14-12-5-10-4-11(7-12)8-13(14)6-10/h10-15,23H,1,4-8H2,2-3H3 |
| InChIKey | GCKDOMCZXZIQGN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|