C25H40F6O6 — CID 129118863
[2,4-bis[2-(4,4,4-trifluoro-3-hydroxy-3-methylbutan-2-yl)oxypropan-2-yl]cyclopentyl] 2-methylprop-2-enoate (PubChem CID 129118863) has the molecular formula C25H40F6O6 and a molecular weight of 550.58 g/mol. Its IUPAC name is [2,4-bis[2-(4,4,4-trifluoro-3-hydroxy-3-methylbutan-2-yl)oxypropan-2-yl]cyclopentyl] 2-methylprop-2-enoate.
| Compound Name | [2,4-bis[2-(4,4,4-trifluoro-3-hydroxy-3-methylbutan-2-yl)oxypropan-2-yl]cyclopentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129118863 |
| Molecular Formula | C25H40F6O6 |
| Molecular Weight | 550.58 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | [2,4-bis[2-(4,4,4-trifluoro-3-hydroxy-3-methylbutan-2-yl)oxypropan-2-yl]cyclopentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC(C(C)(C)OC(C)C(C)(O)C(F)(F)F)CC1C(C)(C)OC(C)C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C25H40F6O6/c1-13(2)19(32)35-18-12-16(20(5,6)36-14(3)22(9,33)24(26,27)28)11-17(18)21(7,8)37-15(4)23(10,34)25(29,30)31/h14-18,33-34H,1,11-12H2,2-10H3 |
| InChIKey | MTHTUPCSKSOHOP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|