C9H5F11O3 — CID 58789608
[4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl] 2-fluoroprop-2-enoate (PubChem CID 58789608) has the molecular formula C9H5F11O3 and a molecular weight of 370.11 g/mol. Its IUPAC name is [4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl] 2-fluoroprop-2-enoate.
| Compound Name | [4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl] 2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 58789608 |
| Molecular Formula | C9H5F11O3 |
| Molecular Weight | 370.11 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | [4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl] 2-fluoroprop-2-enoate |
| SMILES | C=C(F)C(=O)OC(C(F)(F)F)C(F)(F)C(O)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H5F11O3/c1-2(10)3(21)23-4(8(15,16)17)7(13,14)6(22,5(11)12)9(18,19)20/h4-5,22H,1H2 |
| InChIKey | GTVPLGNVQBWFOB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.11 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|