C13H14F10O7S — CID 118463316
1,1,3,3,3-pentafluoro-2-[6-oxo-6-(1,1,1,3,3-pentafluorobutan-2-yloxy)hexanoyl]oxypropane-1-sulfonic acid (PubChem CID 118463316) has the molecular formula C13H14F10O7S and a molecular weight of 504.30 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-[6-oxo-6-(1,1,1,3,3-pentafluorobutan-2-yloxy)hexanoyl]oxypropane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-[6-oxo-6-(1,1,1,3,3-pentafluorobutan-2-yloxy)hexanoyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 118463316 |
| Molecular Formula | C13H14F10O7S |
| Molecular Weight | 504.30 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-[6-oxo-6-(1,1,1,3,3-pentafluorobutan-2-yloxy)hexanoyl]oxypropane-1-sulfonic acid |
| SMILES | CC(F)(F)C(OC(=O)CCCCC(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)C(F)(F)F |
| InChI | InChI=1S/C13H14F10O7S/c1-10(14,15)8(11(16,17)18)29-6(24)4-2-3-5-7(25)30-9(12(19,20)21)13(22,23)31(26,27)28/h8-9H,2-5H2,1H3,(H,26,27,28) |
| InChIKey | XXWRJTJFXMOLOQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|