C7H9F5O5S — CID 167583697
3-oxo-3-(1,1,1,3,3-pentafluorobutan-2-yloxy)propane-1-sulfonic acid (PubChem CID 167583697) has the molecular formula C7H9F5O5S and a molecular weight of 300.20 g/mol. Its IUPAC name is 3-oxo-3-(1,1,1,3,3-pentafluorobutan-2-yloxy)propane-1-sulfonic acid.
| Compound Name | 3-oxo-3-(1,1,1,3,3-pentafluorobutan-2-yloxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 167583697 |
| Molecular Formula | C7H9F5O5S |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 3-oxo-3-(1,1,1,3,3-pentafluorobutan-2-yloxy)propane-1-sulfonic acid |
| SMILES | CC(F)(F)C(OC(=O)CCS(=O)(=O)O)C(F)(F)F |
| InChI | InChI=1S/C7H9F5O5S/c1-6(8,9)5(7(10,11)12)17-4(13)2-3-18(14,15)16/h5H,2-3H2,1H3,(H,14,15,16) |
| InChIKey | MDXVDVUBFHKETK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|