C11H13F6O4Rb — CID 59360543
[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-oxopropyl] 2-methylbutanoate;rubidium(1+) (PubChem CID 59360543) has the molecular formula C11H13F6O4Rb and a molecular weight of 408.68 g/mol. Its IUPAC name is [3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-oxopropyl] 2-methylbutanoate;rubidium(1+).
| Compound Name | [3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-oxopropyl] 2-methylbutanoate;rubidium(1+) |
|---|---|
| PubChem CID | 59360543 |
| Molecular Formula | C11H13F6O4Rb |
| Molecular Weight | 408.68 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | [3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-oxopropyl] 2-methylbutanoate;rubidium(1+) |
| SMILES | CC[C-](C)C(=O)OCCC(=O)OC(C(F)(F)F)C(F)(F)F.[Rb+] |
| InChI | InChI=1S/C11H13F6O4.Rb/c1-3-6(2)8(19)20-5-4-7(18)21-9(10(12,13)14)11(15,16)17;/h9H,3-5H2,1-2H3;/q-1;+1 |
| InChIKey | XYLMOAWROHKBQL-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.68 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|