C13H16F7O4Rb — CID 59360573
[3-(3,3,4,4,5,5,5-heptafluoropentoxy)-3-oxopropyl] 2-methylbutanoate;rubidium(1+) (PubChem CID 59360573) has the molecular formula C13H16F7O4Rb and a molecular weight of 454.72 g/mol. Its IUPAC name is [3-(3,3,4,4,5,5,5-heptafluoropentoxy)-3-oxopropyl] 2-methylbutanoate;rubidium(1+).
| Compound Name | [3-(3,3,4,4,5,5,5-heptafluoropentoxy)-3-oxopropyl] 2-methylbutanoate;rubidium(1+) |
|---|---|
| PubChem CID | 59360573 |
| Molecular Formula | C13H16F7O4Rb |
| Molecular Weight | 454.72 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | [3-(3,3,4,4,5,5,5-heptafluoropentoxy)-3-oxopropyl] 2-methylbutanoate;rubidium(1+) |
| SMILES | CC[C-](C)C(=O)OCCC(=O)OCCC(F)(F)C(F)(F)C(F)(F)F.[Rb+] |
| InChI | InChI=1S/C13H16F7O4.Rb/c1-3-8(2)10(22)24-6-4-9(21)23-7-5-11(14,15)12(16,17)13(18,19)20;/h3-7H2,1-2H3;/q-1;+1 |
| InChIKey | YBWYNIOGTMKNBL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.72 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|