C18H18F9O3Rb — CID 59360564
3,3,4,4,5,5,6,6,6-nonafluorohexyl 2-(4-butan-2-ylphenoxy)acetate;rubidium(1+) (PubChem CID 59360564) has the molecular formula C18H18F9O3Rb and a molecular weight of 538.79 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,6-nonafluorohexyl 2-(4-butan-2-ylphenoxy)acetate;rubidium(1+).
| Compound Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl 2-(4-butan-2-ylphenoxy)acetate;rubidium(1+) |
|---|---|
| PubChem CID | 59360564 |
| Molecular Formula | C18H18F9O3Rb |
| Molecular Weight | 538.79 g/mol |
| Exact Mass | 538.02 |
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl 2-(4-butan-2-ylphenoxy)acetate;rubidium(1+) |
| SMILES | CC[C-](C)c1ccc(OCC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1.[Rb+] |
| InChI | InChI=1S/C18H18F9O3.Rb/c1-3-11(2)12-4-6-13(7-5-12)30-10-14(28)29-9-8-15(19,20)16(21,22)17(23,24)18(25,26)27;/h4-7H,3,8-10H2,1-2H3;/q-1;+1 |
| InChIKey | GFUMUOXUBGBXLQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.79 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|