C38H31F17O8 — CID 102345272
[4-[4-[(2S)-1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)-1-oxopropan-2-yl]oxyphenoxy]carbonylphenyl] 4-pentoxybenzoate (PubChem CID 102345272) has the molecular formula C38H31F17O8 and a molecular weight of 938.62 g/mol. Its IUPAC name is [4-[4-[(2S)-1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)-1-oxopropan-2-yl]oxyphenoxy]carbonylphenyl] 4-pentoxybenzoate.
| Compound Name | [4-[4-[(2S)-1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)-1-oxopropan-2-yl]oxyphenoxy]carbonylphenyl] 4-pentoxybenzoate |
|---|---|
| PubChem CID | 102345272 |
| Molecular Formula | C38H31F17O8 |
| Molecular Weight | 938.62 g/mol |
| Exact Mass | 938.17 |
| IUPAC Name | [4-[4-[(2S)-1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)-1-oxopropan-2-yl]oxyphenoxy]carbonylphenyl] 4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(O[C@@H](C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H31F17O8/c1-3-4-5-19-59-24-10-6-22(7-11-24)29(57)62-26-12-8-23(9-13-26)30(58)63-27-16-14-25(15-17-27)61-21(2)28(56)60-20-18-31(39,40)32(41,42)33(43,44)34(45,46)35(47,48)36(49,50)37(51,52)38(53,54)55/h6-17,21H,3-5,18-20H2,1-2H3/t21-/m0/s1 |
| InChIKey | RPRIREPCEAOZEU-NRFANRHFSA-N |
| XLogP | 11.40 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.62 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|